C10H18F3N — CID 104941345
(1S)-3,3,3-trifluoro-1-(4-methylcyclohexyl)propan-1-amine (PubChem CID 104941345) has the molecular formula C10H18F3N and a molecular weight of 209.25 g/mol. Its IUPAC name is (1S)-3,3,3-trifluoro-1-(4-methylcyclohexyl)propan-1-amine.
| Compound Name | (1S)-3,3,3-trifluoro-1-(4-methylcyclohexyl)propan-1-amine |
|---|---|
| PubChem CID | 104941345 |
| Molecular Formula | C10H18F3N |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (1S)-3,3,3-trifluoro-1-(4-methylcyclohexyl)propan-1-amine |
| SMILES | CC1CCC([C@@H](N)CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H18F3N/c1-7-2-4-8(5-3-7)9(14)6-10(11,12)13/h7-9H,2-6,14H2,1H3/t7?,8?,9-/m0/s1 |
| InChIKey | GBQBQVITUIRXIM-HACHORDNSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |