About (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine
(1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine (PubChem CID 104941610) has the molecular formula C14H19N3O3
and a molecular weight of 277.32 g/mol. Its IUPAC name is (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine.
Molecular Properties
| Compound Name | (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine |
| PubChem CID | 104941610 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine |
| SMILES | COc1cc(-n2cncc2[C@@H](C)N)cc(OC)c1OC |
| InChI | InChI=1S/C14H19N3O3/c1-9(15)11-7-16-8-17(11)10-5-12(18-2)14(20-4)13(6-10)19-3/h5-9H,15H2,1-4H3/t9-/m1/s1 |
| InChIKey | GIWCWGIVQXKASQ-SECBINFHSA-N |
| XLogP | 1.92 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine?
The IUPAC name of (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine (CID 104941610) is (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine.
What is the SMILES notation for (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine?
The canonical SMILES for (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine is COc1cc(-n2cncc2[C@@H](C)N)cc(OC)c1OC.
What is the InChIKey of (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine?
The InChIKey is GIWCWGIVQXKASQ-SECBINFHSA-N. The full InChI is InChI=1S/C14H19N3O3/c1-9(15)11-7-16-8-17(11)10-5-12(18-2)14(20-4)13(6-10)19-3/h5-9H,15H2,1-4H3/t9-/m1/s1.
What are the key properties of (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine?
(1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine has a molecular weight of 277.32 g/mol, XLogP of 1.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1-[3-(3,4,5-trimethoxyphenyl)imidazol-4-yl]ethanamine is sourced from PubChem (CID 104941610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).