C14H17N3S — CID 104941741
1-(4-methylsulfanylphenyl)-5-[(2S)-pyrrolidin-2-yl]imidazole (PubChem CID 104941741) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-5-[(2S)-pyrrolidin-2-yl]imidazole.
| Compound Name | 1-(4-methylsulfanylphenyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
|---|---|
| PubChem CID | 104941741 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
| SMILES | CSc1ccc(-n2cncc2[C@@H]2CCCN2)cc1 |
| InChI | InChI=1S/C14H17N3S/c1-18-12-6-4-11(5-7-12)17-10-15-9-14(17)13-3-2-8-16-13/h4-7,9-10,13,16H,2-3,8H2,1H3/t13-/m0/s1 |
| InChIKey | OUQHJZVGBWBOKI-ZDUSSCGKSA-N |
| XLogP | 3.02 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |