C21H31N — CID 10494261
(1S,3S,3aR,6S,6aS,9aS,9bS)-6-isocyano-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-1,2,3,3a,4,5,6a,7,9a,9b-decahydrophenalene (PubChem CID 10494261) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (1S,3S,3aR,6S,6aS,9aS,9bS)-6-isocyano-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-1,2,3,3a,4,5,6a,7,9a,9b-decahydrophenalene.
| Compound Name | (1S,3S,3aR,6S,6aS,9aS,9bS)-6-isocyano-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-1,2,3,3a,4,5,6a,7,9a,9b-decahydrophenalene |
|---|---|
| PubChem CID | 10494261 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (1S,3S,3aR,6S,6aS,9aS,9bS)-6-isocyano-3,6,9-trimethyl-1-(2-methylprop-1-enyl)-1,2,3,3a,4,5,6a,7,9a,9b-decahydrophenalene |
| SMILES | [C-]#[N+][C@@]1(C)CC[C@H]2[C@H]3[C@@H](C(C)=CC[C@@H]31)[C@H](C=C(C)C)C[C@@H]2C |
| InChI | InChI=1S/C21H31N/c1-13(2)11-16-12-15(4)17-9-10-21(5,22-6)18-8-7-14(3)19(16)20(17)18/h7,11,15-20H,8-10,12H2,1-5H3/t15-,16+,17+,18-,19-,20+,21-/m0/s1 |
| InChIKey | JMZUVWGIUGYJJE-QCPSMULASA-N |
| XLogP | 5.90 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|