C10H17N3O — CID 104942924
(1R)-1-[3-(oxolan-3-ylmethyl)imidazol-4-yl]ethanamine (PubChem CID 104942924) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is (1R)-1-[3-(oxolan-3-ylmethyl)imidazol-4-yl]ethanamine.
| Compound Name | (1R)-1-[3-(oxolan-3-ylmethyl)imidazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 104942924 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (1R)-1-[3-(oxolan-3-ylmethyl)imidazol-4-yl]ethanamine |
| SMILES | C[C@@H](N)c1cncn1CC1CCOC1 |
| InChI | InChI=1S/C10H17N3O/c1-8(11)10-4-12-7-13(10)5-9-2-3-14-6-9/h4,7-9H,2-3,5-6,11H2,1H3/t8-,9?/m1/s1 |
| InChIKey | BIDNHYWOOBAGGJ-VEDVMXKPSA-N |
| XLogP | 0.94 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |