C18H19N3 — CID 104942995
1-(naphthalen-1-ylmethyl)-5-[(2S)-pyrrolidin-2-yl]imidazole (PubChem CID 104942995) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 1-(naphthalen-1-ylmethyl)-5-[(2S)-pyrrolidin-2-yl]imidazole.
| Compound Name | 1-(naphthalen-1-ylmethyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
|---|---|
| PubChem CID | 104942995 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 1-(naphthalen-1-ylmethyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
| SMILES | c1ccc2c(Cn3cncc3[C@@H]3CCCN3)cccc2c1 |
| InChI | InChI=1S/C18H19N3/c1-2-8-16-14(5-1)6-3-7-15(16)12-21-13-19-11-18(21)17-9-4-10-20-17/h1-3,5-8,11,13,17,20H,4,9-10,12H2/t17-/m0/s1 |
| InChIKey | CUASPRFJHATUEN-KRWDZBQOSA-N |
| XLogP | 3.51 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |