C13H23N3 — CID 104943295
1-(2,3-dimethylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole (PubChem CID 104943295) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is 1-(2,3-dimethylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole.
| Compound Name | 1-(2,3-dimethylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
|---|---|
| PubChem CID | 104943295 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | 1-(2,3-dimethylbutyl)-5-[(2S)-pyrrolidin-2-yl]imidazole |
| SMILES | CC(C)C(C)Cn1cncc1[C@@H]1CCCN1 |
| InChI | InChI=1S/C13H23N3/c1-10(2)11(3)8-16-9-14-7-13(16)12-5-4-6-15-12/h7,9-12,15H,4-6,8H2,1-3H3/t11?,12-/m0/s1 |
| InChIKey | PDWAUGLAMJYUIC-KIYNQFGBSA-N |
| XLogP | 2.60 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |