C15H23BrO — CID 10494359
(3R,4R,6R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol (PubChem CID 10494359) has the molecular formula C15H23BrO and a molecular weight of 299.25 g/mol. Its IUPAC name is (3R,4R,6R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol.
| Compound Name | (3R,4R,6R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol |
|---|---|
| PubChem CID | 10494359 |
| Molecular Formula | C15H23BrO |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | (3R,4R,6R)-4-bromo-1,5,5,9-tetramethylspiro[5.5]undeca-1,9-dien-3-ol |
| SMILES | CC1=CC[C@]2(CC1)C(C)=C[C@@H](O)[C@H](Br)C2(C)C |
| InChI | InChI=1S/C15H23BrO/c1-10-5-7-15(8-6-10)11(2)9-12(17)13(16)14(15,3)4/h5,9,12-13,17H,6-8H2,1-4H3/t12-,13+,15+/m1/s1 |
| InChIKey | GBUVGHSRKIJUDI-IPYPFGDCSA-N |
| XLogP | 4.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|