C13H13ClF3N3 — CID 104944066
(1R)-1-[3-[3-chloro-5-(trifluoromethyl)phenyl]imidazol-4-yl]propan-1-amine (PubChem CID 104944066) has the molecular formula C13H13ClF3N3 and a molecular weight of 303.72 g/mol. Its IUPAC name is (1R)-1-[3-[3-chloro-5-(trifluoromethyl)phenyl]imidazol-4-yl]propan-1-amine.
| Compound Name | (1R)-1-[3-[3-chloro-5-(trifluoromethyl)phenyl]imidazol-4-yl]propan-1-amine |
|---|---|
| PubChem CID | 104944066 |
| Molecular Formula | C13H13ClF3N3 |
| Molecular Weight | 303.72 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | (1R)-1-[3-[3-chloro-5-(trifluoromethyl)phenyl]imidazol-4-yl]propan-1-amine |
| SMILES | CC[C@@H](N)c1cncn1-c1cc(Cl)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H13ClF3N3/c1-2-11(18)12-6-19-7-20(12)10-4-8(13(15,16)17)3-9(14)5-10/h3-7,11H,2,18H2,1H3/t11-/m1/s1 |
| InChIKey | RCVCPDCIVQRTCC-LLVKDONJSA-N |
| XLogP | 3.95 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.72 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |