About (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine
(4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine (PubChem CID 104945034) has the molecular formula C16H23ClN2O
and a molecular weight of 294.83 g/mol. Its IUPAC name is (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine.
Molecular Properties
| Compound Name | (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine |
| PubChem CID | 104945034 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine |
| SMILES | CC(C)N1CCC2(CC1)C[C@@H](N)c1cc(Cl)ccc1O2 |
| InChI | InChI=1S/C16H23ClN2O/c1-11(2)19-7-5-16(6-8-19)10-14(18)13-9-12(17)3-4-15(13)20-16/h3-4,9,11,14H,5-8,10,18H2,1-2H3/t14-/m1/s1 |
| InChIKey | DZZXJEOXANAMIQ-CQSZACIVSA-N |
| XLogP | 3.37 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine?
The IUPAC name of (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine (CID 104945034) is (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine.
What is the SMILES notation for (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine?
The canonical SMILES for (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine is CC(C)N1CCC2(CC1)C[C@@H](N)c1cc(Cl)ccc1O2.
What is the InChIKey of (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine?
The InChIKey is DZZXJEOXANAMIQ-CQSZACIVSA-N. The full InChI is InChI=1S/C16H23ClN2O/c1-11(2)19-7-5-16(6-8-19)10-14(18)13-9-12(17)3-4-15(13)20-16/h3-4,9,11,14H,5-8,10,18H2,1-2H3/t14-/m1/s1.
What are the key properties of (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine?
(4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine has a molecular weight of 294.83 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-6-chloro-1'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-piperidine]-4-amine is sourced from PubChem (CID 104945034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).