C16H16ClNO — CID 104945286
(4S)-2-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104945286) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is (4S)-2-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4S)-2-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104945286 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (4S)-2-benzyl-6-chloro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@H]1CC(Cc2ccccc2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H16ClNO/c17-12-6-7-16-14(9-12)15(18)10-13(19-16)8-11-4-2-1-3-5-11/h1-7,9,13,15H,8,10,18H2/t13?,15-/m0/s1 |
| InChIKey | DBCRSFCTALMXBU-WUJWULDRSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |