About (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine
(4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine (PubChem CID 104945533) has the molecular formula C13H17BrN2O
and a molecular weight of 297.20 g/mol. Its IUPAC name is (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine.
Molecular Properties
| Compound Name | (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine |
| PubChem CID | 104945533 |
| Molecular Formula | C13H17BrN2O |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine |
| SMILES | CN1CCC2(C[C@@H](N)c3ccc(Br)cc3O2)C1 |
| InChI | InChI=1S/C13H17BrN2O/c1-16-5-4-13(8-16)7-11(15)10-3-2-9(14)6-12(10)17-13/h2-3,6,11H,4-5,7-8,15H2,1H3/t11-,13?/m1/s1 |
| InChIKey | YIDJLVVMYVXXOA-JTDNENJMSA-N |
| XLogP | 2.31 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine?
The IUPAC name of (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine (CID 104945533) is (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine.
What is the SMILES notation for (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine?
The canonical SMILES for (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine is CN1CCC2(C[C@@H](N)c3ccc(Br)cc3O2)C1.
What is the InChIKey of (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine?
The InChIKey is YIDJLVVMYVXXOA-JTDNENJMSA-N. The full InChI is InChI=1S/C13H17BrN2O/c1-16-5-4-13(8-16)7-11(15)10-3-2-9(14)6-12(10)17-13/h2-3,6,11H,4-5,7-8,15H2,1H3/t11-,13?/m1/s1.
What are the key properties of (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine?
(4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine has a molecular weight of 297.20 g/mol, XLogP of 2.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-7-bromo-1'-methylspiro[3,4-dihydrochromene-2,3'-pyrrolidine]-4-amine is sourced from PubChem (CID 104945533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).