About 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one (PubChem CID 10494600) has the molecular formula C20H30O2
and a molecular weight of 302.46 g/mol. Its IUPAC name is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one.
Molecular Properties
| Compound Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one |
| PubChem CID | 10494600 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one |
| SMILES | CCCCCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C20H30O2/c1-7-8-9-10-17(21)14-11-15(19(2,3)4)18-16(12-14)20(5,6)13-22-18/h11-12H,7-10,13H2,1-6H3 |
| InChIKey | WLHKECSKEZIEND-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one?
The IUPAC name of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one (CID 10494600) is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one.
What is the SMILES notation for 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one?
The canonical SMILES for 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one is CCCCCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2.
What is the InChIKey of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one?
The InChIKey is WLHKECSKEZIEND-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30O2/c1-7-8-9-10-17(21)14-11-15(19(2,3)4)18-16(12-14)20(5,6)13-22-18/h11-12H,7-10,13H2,1-6H3.
What are the key properties of 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one?
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one has a molecular weight of 302.46 g/mol, XLogP of 5.42, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hexan-1-one is sourced from PubChem (CID 10494600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).