C18H29N3O — CID 10494677
2,4,6,7-tetramethyl-2-[(4-methylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine (PubChem CID 10494677) has the molecular formula C18H29N3O and a molecular weight of 303.45 g/mol. Its IUPAC name is 2,4,6,7-tetramethyl-2-[(4-methylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine.
| Compound Name | 2,4,6,7-tetramethyl-2-[(4-methylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10494677 |
| Molecular Formula | C18H29N3O |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.23 |
| IUPAC Name | 2,4,6,7-tetramethyl-2-[(4-methylpiperazin-1-yl)methyl]-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CN1CCN(C)CC1)O2 |
| InChI | InChI=1S/C18H29N3O/c1-12-13(2)17-15(14(3)16(12)19)10-18(4,22-17)11-21-8-6-20(5)7-9-21/h6-11,19H2,1-5H3 |
| InChIKey | DJRAXPXYCLABSD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|