C16H16ClNO3 — CID 104946997
4-[(4R)-4-amino-6-methoxy-3,4-dihydro-2H-chromen-2-yl]-2-chlorophenol (PubChem CID 104946997) has the molecular formula C16H16ClNO3 and a molecular weight of 305.76 g/mol. Its IUPAC name is 4-[(4R)-4-amino-6-methoxy-3,4-dihydro-2H-chromen-2-yl]-2-chlorophenol.
| Compound Name | 4-[(4R)-4-amino-6-methoxy-3,4-dihydro-2H-chromen-2-yl]-2-chlorophenol |
|---|---|
| PubChem CID | 104946997 |
| Molecular Formula | C16H16ClNO3 |
| Molecular Weight | 305.76 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | 4-[(4R)-4-amino-6-methoxy-3,4-dihydro-2H-chromen-2-yl]-2-chlorophenol |
| SMILES | COc1ccc2c(c1)[C@H](N)CC(c1ccc(O)c(Cl)c1)O2 |
| InChI | InChI=1S/C16H16ClNO3/c1-20-10-3-5-15-11(7-10)13(18)8-16(21-15)9-2-4-14(19)12(17)6-9/h2-7,13,16,19H,8,18H2,1H3/t13-,16?/m1/s1 |
| InChIKey | URGJSIYBTWANSL-JBZHPUCOSA-N |
| XLogP | 3.58 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |