C13H16BrNO — CID 104947179
(4S)-6-bromo-2-cyclopropyl-2-methyl-3,4-dihydrochromen-4-amine (PubChem CID 104947179) has the molecular formula C13H16BrNO and a molecular weight of 282.18 g/mol. Its IUPAC name is (4S)-6-bromo-2-cyclopropyl-2-methyl-3,4-dihydrochromen-4-amine.
| Compound Name | (4S)-6-bromo-2-cyclopropyl-2-methyl-3,4-dihydrochromen-4-amine |
|---|---|
| PubChem CID | 104947179 |
| Molecular Formula | C13H16BrNO |
| Molecular Weight | 282.18 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | (4S)-6-bromo-2-cyclopropyl-2-methyl-3,4-dihydrochromen-4-amine |
| SMILES | CC1(C2CC2)C[C@H](N)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C13H16BrNO/c1-13(8-2-3-8)7-11(15)10-6-9(14)4-5-12(10)16-13/h4-6,8,11H,2-3,7,15H2,1H3/t11-,13?/m0/s1 |
| InChIKey | ABUBSGNXICWISY-AMGKYWFPSA-N |
| XLogP | 3.40 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.18 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |