About (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine
(4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine (PubChem CID 10494737) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine.
Molecular Properties
| Compound Name | (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine |
| PubChem CID | 10494737 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine |
| SMILES | [H]/N=C(/c1ccc(-c2cn3ccccc3n2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C19H20N4/c20-19(22-11-3-1-4-12-22)16-9-7-15(8-10-16)17-14-23-13-5-2-6-18(23)21-17/h2,5-10,13-14,20H,1,3-4,11-12H2/b20-19- |
| InChIKey | CZHVKDGNJMLYBZ-VXPUYCOJSA-N |
| XLogP | 3.81 |
| TPSA | 44.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine?
The IUPAC name of (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine (CID 10494737) is (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine.
What is the SMILES notation for (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine?
The canonical SMILES for (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine is [H]/N=C(/c1ccc(-c2cn3ccccc3n2)cc1)N1CCCCC1.
What is the InChIKey of (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine?
The InChIKey is CZHVKDGNJMLYBZ-VXPUYCOJSA-N. The full InChI is InChI=1S/C19H20N4/c20-19(22-11-3-1-4-12-22)16-9-7-15(8-10-16)17-14-23-13-5-2-6-18(23)21-17/h2,5-10,13-14,20H,1,3-4,11-12H2/b20-19-.
What are the key properties of (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine?
(4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine has a molecular weight of 304.40 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-imidazo[1,2-a]pyridin-2-ylphenyl)-piperidin-1-ylmethanimine is sourced from PubChem (CID 10494737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).