About (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol
(4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104948110) has the molecular formula C16H23FO2
and a molecular weight of 266.36 g/mol. Its IUPAC name is (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol.
Molecular Properties
| Compound Name | (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol |
| PubChem CID | 104948110 |
| Molecular Formula | C16H23FO2 |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCCCCCCC1C[C@H](O)c2cc(F)ccc2O1 |
| InChI | InChI=1S/C16H23FO2/c1-2-3-4-5-6-7-13-11-15(18)14-10-12(17)8-9-16(14)19-13/h8-10,13,15,18H,2-7,11H2,1H3/t13?,15-/m0/s1 |
| InChIKey | BESXFYSJYCTILK-WUJWULDRSA-N |
| XLogP | 4.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol?
The IUPAC name of (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol (CID 104948110) is (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol.
What is the SMILES notation for (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol?
The canonical SMILES for (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol is CCCCCCCC1C[C@H](O)c2cc(F)ccc2O1.
What is the InChIKey of (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol?
The InChIKey is BESXFYSJYCTILK-WUJWULDRSA-N. The full InChI is InChI=1S/C16H23FO2/c1-2-3-4-5-6-7-13-11-15(18)14-10-12(17)8-9-16(14)19-13/h8-10,13,15,18H,2-7,11H2,1H3/t13?,15-/m0/s1.
What are the key properties of (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol?
(4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol has a molecular weight of 266.36 g/mol, XLogP of 4.37, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-6-fluoro-2-heptyl-3,4-dihydro-2H-chromen-4-ol is sourced from PubChem (CID 104948110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).