C10H11BrO2 — CID 104949397
(4R)-7-bromo-2-methyl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949397) has the molecular formula C10H11BrO2 and a molecular weight of 243.10 g/mol. Its IUPAC name is (4R)-7-bromo-2-methyl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-7-bromo-2-methyl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949397 |
| Molecular Formula | C10H11BrO2 |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | (4R)-7-bromo-2-methyl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CC1C[C@@H](O)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C10H11BrO2/c1-6-4-9(12)8-3-2-7(11)5-10(8)13-6/h2-3,5-6,9,12H,4H2,1H3/t6?,9-/m1/s1 |
| InChIKey | UCPVIPUSBJVPGW-IOJJLOCKSA-N |
| XLogP | 2.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |