About N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide
N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide (PubChem CID 10494954) has the molecular formula C18H17N3S
and a molecular weight of 307.42 g/mol. Its IUPAC name is N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide.
Molecular Properties
| Compound Name | N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide |
| PubChem CID | 10494954 |
| Molecular Formula | C18H17N3S |
| Molecular Weight | 307.42 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide |
| SMILES | CNC(=S)c1c(C)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C18H17N3S/c1-13-16(18(22)19-2)17(14-9-5-3-6-10-14)21(20-13)15-11-7-4-8-12-15/h3-12H,1-2H3,(H,19,22) |
| InChIKey | HXXHWTXVQSFYOI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide?
The IUPAC name of N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide (CID 10494954) is N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide.
What is the SMILES notation for N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide?
The canonical SMILES for N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide is CNC(=S)c1c(C)nn(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide?
The InChIKey is HXXHWTXVQSFYOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N3S/c1-13-16(18(22)19-2)17(14-9-5-3-6-10-14)21(20-13)15-11-7-4-8-12-15/h3-12H,1-2H3,(H,19,22).
What are the key properties of N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide?
N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide has a molecular weight of 307.42 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-1,5-diphenylpyrazole-4-carbothioamide is sourced from PubChem (CID 10494954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).