C14H16BrF3O2 — CID 104951175
(4S)-6-bromo-2-methyl-2-(4,4,4-trifluorobutyl)-3,4-dihydrochromen-4-ol (PubChem CID 104951175) has the molecular formula C14H16BrF3O2 and a molecular weight of 353.18 g/mol. Its IUPAC name is (4S)-6-bromo-2-methyl-2-(4,4,4-trifluorobutyl)-3,4-dihydrochromen-4-ol.
| Compound Name | (4S)-6-bromo-2-methyl-2-(4,4,4-trifluorobutyl)-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104951175 |
| Molecular Formula | C14H16BrF3O2 |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | (4S)-6-bromo-2-methyl-2-(4,4,4-trifluorobutyl)-3,4-dihydrochromen-4-ol |
| SMILES | CC1(CCCC(F)(F)F)C[C@H](O)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C14H16BrF3O2/c1-13(5-2-6-14(16,17)18)8-11(19)10-7-9(15)3-4-12(10)20-13/h3-4,7,11,19H,2,5-6,8H2,1H3/t11-,13?/m0/s1 |
| InChIKey | HLFJEHKHYUGUOT-AMGKYWFPSA-N |
| XLogP | 4.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |