C14H22F3N3O3 — CID 104952201
tert-butyl N-[2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]ethyl]carbamate (PubChem CID 104952201) has the molecular formula C14H22F3N3O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 104952201 |
| Molecular Formula | C14H22F3N3O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | tert-butyl N-[2-[3-[2-(2,2,2-trifluoroethoxy)ethyl]imidazol-4-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCc1cncn1CCOCC(F)(F)F |
| InChI | InChI=1S/C14H22F3N3O3/c1-13(2,3)23-12(21)19-5-4-11-8-18-10-20(11)6-7-22-9-14(15,16)17/h8,10H,4-7,9H2,1-3H3,(H,19,21) |
| InChIKey | LSJFHVTUEBXLJR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|