C7H7Br2N5 — CID 104952375
4-[(3,5-dibromopyrazol-1-yl)methyl]-1-methyltriazole (PubChem CID 104952375) has the molecular formula C7H7Br2N5 and a molecular weight of 320.98 g/mol. Its IUPAC name is 4-[(3,5-dibromopyrazol-1-yl)methyl]-1-methyltriazole.
| Compound Name | 4-[(3,5-dibromopyrazol-1-yl)methyl]-1-methyltriazole |
|---|---|
| PubChem CID | 104952375 |
| Molecular Formula | C7H7Br2N5 |
| Molecular Weight | 320.98 g/mol |
| Exact Mass | 318.91 |
| IUPAC Name | 4-[(3,5-dibromopyrazol-1-yl)methyl]-1-methyltriazole |
| SMILES | Cn1cc(Cn2nc(Br)cc2Br)nn1 |
| InChI | InChI=1S/C7H7Br2N5/c1-13-3-5(10-12-13)4-14-7(9)2-6(8)11-14/h2-3H,4H2,1H3 |
| InChIKey | GXVYPSJPMFWPPC-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.98 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |