C16H24O6 — CID 10495303
(1R,5R,8R)-8-acetyl-9-butoxy-4,4-dimethyl-2,6,11-trioxatricyclo[6.2.1.01,5]undecan-7-one (PubChem CID 10495303) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is (1R,5R,8R)-8-acetyl-9-butoxy-4,4-dimethyl-2,6,11-trioxatricyclo[6.2.1.01,5]undecan-7-one.
| Compound Name | (1R,5R,8R)-8-acetyl-9-butoxy-4,4-dimethyl-2,6,11-trioxatricyclo[6.2.1.01,5]undecan-7-one |
|---|---|
| PubChem CID | 10495303 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | (1R,5R,8R)-8-acetyl-9-butoxy-4,4-dimethyl-2,6,11-trioxatricyclo[6.2.1.01,5]undecan-7-one |
| SMILES | CCCCOC1C[C@]23OCC(C)(C)[C@H]2OC(=O)[C@@]1(C(C)=O)O3 |
| InChI | InChI=1S/C16H24O6/c1-5-6-7-19-11-8-15-12(14(3,4)9-20-15)21-13(18)16(11,22-15)10(2)17/h11-12H,5-9H2,1-4H3/t11?,12-,15-,16+/m1/s1 |
| InChIKey | LLUDUCZJXUYFGT-ARQBPDDDSA-N |
| XLogP | 1.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|