About tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate
tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate (PubChem CID 104954005) has the molecular formula C13H22F2N4O2
and a molecular weight of 304.34 g/mol. Its IUPAC name is tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate |
| PubChem CID | 104954005 |
| Molecular Formula | C13H22F2N4O2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate |
| SMILES | Cc1[nH]ncc1CNCC(F)(F)CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22F2N4O2/c1-9-10(6-18-19-9)5-16-7-13(14,15)8-17-11(20)21-12(2,3)4/h6,16H,5,7-8H2,1-4H3,(H,17,20)(H,18,19) |
| InChIKey | KPZVPFHUZOISPZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate?
The IUPAC name of tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate (CID 104954005) is tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate.
What is the SMILES notation for tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate?
The canonical SMILES for tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate is Cc1[nH]ncc1CNCC(F)(F)CNC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate?
The InChIKey is KPZVPFHUZOISPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22F2N4O2/c1-9-10(6-18-19-9)5-16-7-13(14,15)8-17-11(20)21-12(2,3)4/h6,16H,5,7-8H2,1-4H3,(H,17,20)(H,18,19).
What are the key properties of tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate?
tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate has a molecular weight of 304.34 g/mol, XLogP of 1.97, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2,2-difluoro-3-[(5-methyl-1H-pyrazol-4-yl)methylamino]propyl]carbamate is sourced from PubChem (CID 104954005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).