About tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate
tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate (PubChem CID 104954063) has the molecular formula C13H20F2N2O2S
and a molecular weight of 306.38 g/mol. Its IUPAC name is tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate |
| PubChem CID | 104954063 |
| Molecular Formula | C13H20F2N2O2S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(F)(F)CNCc1ccsc1 |
| InChI | InChI=1S/C13H20F2N2O2S/c1-12(2,3)19-11(18)17-9-13(14,15)8-16-6-10-4-5-20-7-10/h4-5,7,16H,6,8-9H2,1-3H3,(H,17,18) |
| InChIKey | HUZFIJWZKNZPTL-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate?
The IUPAC name of tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate (CID 104954063) is tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate.
What is the SMILES notation for tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate?
The canonical SMILES for tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate is CC(C)(C)OC(=O)NCC(F)(F)CNCc1ccsc1.
What is the InChIKey of tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate?
The InChIKey is HUZFIJWZKNZPTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F2N2O2S/c1-12(2,3)19-11(18)17-9-13(14,15)8-16-6-10-4-5-20-7-10/h4-5,7,16H,6,8-9H2,1-3H3,(H,17,18).
What are the key properties of tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate?
tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate has a molecular weight of 306.38 g/mol, XLogP of 3.00, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2,2-difluoro-3-(thiophen-3-ylmethylamino)propyl]carbamate is sourced from PubChem (CID 104954063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).