C21H31NO — CID 10495424
(6S,8aS)-5,5,8a-trimethyl-2-(3-phenylpropyl)-3,6,7,8-tetrahydro-1H-isoquinolin-6-ol (PubChem CID 10495424) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is (6S,8aS)-5,5,8a-trimethyl-2-(3-phenylpropyl)-3,6,7,8-tetrahydro-1H-isoquinolin-6-ol.
| Compound Name | (6S,8aS)-5,5,8a-trimethyl-2-(3-phenylpropyl)-3,6,7,8-tetrahydro-1H-isoquinolin-6-ol |
|---|---|
| PubChem CID | 10495424 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | (6S,8aS)-5,5,8a-trimethyl-2-(3-phenylpropyl)-3,6,7,8-tetrahydro-1H-isoquinolin-6-ol |
| SMILES | CC1(C)C2=CCN(CCCc3ccccc3)C[C@@]2(C)CC[C@@H]1O |
| InChI | InChI=1S/C21H31NO/c1-20(2)18-12-15-22(16-21(18,3)13-11-19(20)23)14-7-10-17-8-5-4-6-9-17/h4-6,8-9,12,19,23H,7,10-11,13-16H2,1-3H3/t19-,21+/m0/s1 |
| InChIKey | IYVLNEGYKHKZKD-PZJWPPBQSA-N |
| XLogP | 4.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|