C12H10ClN3O2 — CID 104954751
N-(6-chloro-5-methyl-3-pyridinyl)-3-hydroxypyridine-2-carboxamide (PubChem CID 104954751) has the molecular formula C12H10ClN3O2 and a molecular weight of 263.68 g/mol. Its IUPAC name is N-(6-chloro-5-methyl-3-pyridinyl)-3-hydroxypyridine-2-carboxamide.
| Compound Name | N-(6-chloro-5-methyl-3-pyridinyl)-3-hydroxypyridine-2-carboxamide |
|---|---|
| PubChem CID | 104954751 |
| Molecular Formula | C12H10ClN3O2 |
| Molecular Weight | 263.68 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-(6-chloro-5-methyl-3-pyridinyl)-3-hydroxypyridine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ncccc2O)cnc1Cl |
| InChI | InChI=1S/C12H10ClN3O2/c1-7-5-8(6-15-11(7)13)16-12(18)10-9(17)3-2-4-14-10/h2-6,17H,1H3,(H,16,18) |
| InChIKey | WPLPMPMBMAFFSK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|