C9H12F4N2O — CID 104954964
2,2,3,3-tetrafluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)propanamide (PubChem CID 104954964) has the molecular formula C9H12F4N2O and a molecular weight of 240.20 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)propanamide.
| Compound Name | 2,2,3,3-tetrafluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)propanamide |
|---|---|
| PubChem CID | 104954964 |
| Molecular Formula | C9H12F4N2O |
| Molecular Weight | 240.20 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2,2,3,3-tetrafluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)propanamide |
| SMILES | O=C(NCC1=CCNCC1)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H12F4N2O/c10-7(11)9(12,13)8(16)15-5-6-1-3-14-4-2-6/h1,7,14H,2-5H2,(H,15,16) |
| InChIKey | PLUQOJDVRFLFER-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.20 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|