About (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone (PubChem CID 10495564) has the molecular formula C18H21NO2S
and a molecular weight of 315.44 g/mol. Its IUPAC name is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone.
Molecular Properties
| Compound Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone |
| PubChem CID | 10495564 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone |
| SMILES | CC(C)(C)c1cc(C(=O)c2nccs2)cc2c1OCC2(C)C |
| InChI | InChI=1S/C18H21NO2S/c1-17(2,3)12-8-11(14(20)16-19-6-7-22-16)9-13-15(12)21-10-18(13,4)5/h6-9H,10H2,1-5H3 |
| InChIKey | ZMRVFTKMHVFUDM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone?
The IUPAC name of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone (CID 10495564) is (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone.
What is the SMILES notation for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone?
The canonical SMILES for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone is CC(C)(C)c1cc(C(=O)c2nccs2)cc2c1OCC2(C)C.
What is the InChIKey of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone?
The InChIKey is ZMRVFTKMHVFUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2S/c1-17(2,3)12-8-11(14(20)16-19-6-7-22-16)9-13-15(12)21-10-18(13,4)5/h6-9H,10H2,1-5H3.
What are the key properties of (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone?
(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone has a molecular weight of 315.44 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-(1,3-thiazol-2-yl)methanone is sourced from PubChem (CID 10495564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).