C14H23N3 — CID 104955790
N-(3-cyclopropylcyclohexyl)-1,3-dimethylpyrazol-4-amine (PubChem CID 104955790) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is N-(3-cyclopropylcyclohexyl)-1,3-dimethylpyrazol-4-amine.
| Compound Name | N-(3-cyclopropylcyclohexyl)-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 104955790 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | N-(3-cyclopropylcyclohexyl)-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)cc1NC1CCCC(C2CC2)C1 |
| InChI | InChI=1S/C14H23N3/c1-10-14(9-17(2)16-10)15-13-5-3-4-12(8-13)11-6-7-11/h9,11-13,15H,3-8H2,1-2H3 |
| InChIKey | TUAORXKPNIXVLM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |