About O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate
O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate (PubChem CID 10495620) has the molecular formula C10H12N4O4S2
and a molecular weight of 316.36 g/mol. Its IUPAC name is O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate.
Molecular Properties
| Compound Name | O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate |
| PubChem CID | 10495620 |
| Molecular Formula | C10H12N4O4S2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate |
| SMILES | COC(=S)Nc1ccc(S(=O)(=O)N(C)C)c2nonc12 |
| InChI | InChI=1S/C10H12N4O4S2/c1-14(2)20(15,16)7-5-4-6(11-10(19)17-3)8-9(7)13-18-12-8/h4-5H,1-3H3,(H,11,19) |
| InChIKey | HVEVWBUAPVWEBE-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 97.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate?
The IUPAC name of O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate (CID 10495620) is O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate.
What is the SMILES notation for O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate?
The canonical SMILES for O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate is COC(=S)Nc1ccc(S(=O)(=O)N(C)C)c2nonc12.
What is the InChIKey of O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate?
The InChIKey is HVEVWBUAPVWEBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O4S2/c1-14(2)20(15,16)7-5-4-6(11-10(19)17-3)8-9(7)13-18-12-8/h4-5H,1-3H3,(H,11,19).
What are the key properties of O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate?
O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate has a molecular weight of 316.36 g/mol, XLogP of 0.82, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for O-methyl N-[4-(dimethylsulfamoyl)-2,1,3-benzoxadiazol-7-yl]carbamothioate is sourced from PubChem (CID 10495620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).