C14H24N2O3 — CID 104956817
N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 104956817) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 104956817 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | O=C(CN1CCCCCC1=O)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C14H24N2O3/c17-12-7-4-3-6-11(12)15-13(18)10-16-9-5-1-2-8-14(16)19/h11-12,17H,1-10H2,(H,15,18)/t11-,12-/m0/s1 |
| InChIKey | DKGZCPYBGSDAJC-RYUDHWBXSA-N |
| XLogP | 0.81 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |