C15H18N2O4 — CID 104957458
N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide (PubChem CID 104957458) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
|---|---|
| PubChem CID | 104957458 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-2-(2-oxo-1,3-benzoxazol-3-yl)acetamide |
| SMILES | O=C(Cn1c(=O)oc2ccccc21)N[C@H]1CCCC[C@@H]1O |
| InChI | InChI=1S/C15H18N2O4/c18-12-7-3-1-5-10(12)16-14(19)9-17-11-6-2-4-8-13(11)21-15(17)20/h2,4,6,8,10,12,18H,1,3,5,7,9H2,(H,16,19)/t10-,12-/m0/s1 |
| InChIKey | NYEBGRKNXMJMSA-JQWIXIFHSA-N |
| XLogP | 1.01 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |