C14H13FN2O2 — CID 104957562
4-fluoro-2-hydroxy-N-[(3-methyl-4-pyridinyl)methyl]benzamide (PubChem CID 104957562) has the molecular formula C14H13FN2O2 and a molecular weight of 260.27 g/mol. Its IUPAC name is 4-fluoro-2-hydroxy-N-[(3-methyl-4-pyridinyl)methyl]benzamide.
| Compound Name | 4-fluoro-2-hydroxy-N-[(3-methyl-4-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 104957562 |
| Molecular Formula | C14H13FN2O2 |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-fluoro-2-hydroxy-N-[(3-methyl-4-pyridinyl)methyl]benzamide |
| SMILES | Cc1cnccc1CNC(=O)c1ccc(F)cc1O |
| InChI | InChI=1S/C14H13FN2O2/c1-9-7-16-5-4-10(9)8-17-14(19)12-3-2-11(15)6-13(12)18/h2-7,18H,8H2,1H3,(H,17,19) |
| InChIKey | LQVXVFXZMSYJJU-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |