C20H30O3 — CID 10495801
(1R,2Z,4S,6E,10E,14R)-4-hydroxy-7,11,15,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-triene-3-carboxylic acid (PubChem CID 10495801) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2Z,4S,6E,10E,14R)-4-hydroxy-7,11,15,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-triene-3-carboxylic acid.
| Compound Name | (1R,2Z,4S,6E,10E,14R)-4-hydroxy-7,11,15,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-triene-3-carboxylic acid |
|---|---|
| PubChem CID | 10495801 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2Z,4S,6E,10E,14R)-4-hydroxy-7,11,15,15-tetramethylbicyclo[12.1.0]pentadeca-2,6,10-triene-3-carboxylic acid |
| SMILES | C/C1=C\C[C@H](O)/C(C(=O)O)=C/[C@@H]2[C@@H](CC/C(C)=C/CC1)C2(C)C |
| InChI | InChI=1S/C20H30O3/c1-13-6-5-7-14(2)9-11-18(21)15(19(22)23)12-17-16(10-8-13)20(17,3)4/h6,9,12,16-18,21H,5,7-8,10-11H2,1-4H3,(H,22,23)/b13-6+,14-9+,15-12-/t16-,17-,18+/m1/s1 |
| InChIKey | KKLGUSXHEBWCLC-ISZOJTMNSA-N |
| XLogP | 4.49 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|