About CID 10495848
CID 10495848 (PubChem CID 10495848) has the molecular formula C19H21FeN+2
and a molecular weight of 319.23 g/mol.
Molecular Properties
| Compound Name | CID 10495848 |
| PubChem CID | 10495848 |
| Molecular Formula | C19H21FeN+2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | — |
| SMILES | C=C1/C(=C\[C]2[CH][CH][CH][CH]2)N2CCC1CC2.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C14H16N.C5H5.Fe/c1-11-13-6-8-15(9-7-13)14(11)10-12-4-2-3-5-12;1-2-4-5-3-1;/h2-5,10,13H,1,6-9H2;1-5H;/q;;+2/b14-10+;; |
| InChIKey | PSMDVOSLKFAHBQ-YZEJZXAXSA-N |
| XLogP | 3.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10495848 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10495848?
The IUPAC name of CID 10495848 (CID 10495848) is not available.
What is the SMILES notation for CID 10495848?
The canonical SMILES for CID 10495848 is C=C1/C(=C\[C]2[CH][CH][CH][CH]2)N2CCC1CC2.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10495848?
The InChIKey is PSMDVOSLKFAHBQ-YZEJZXAXSA-N. The full InChI is InChI=1S/C14H16N.C5H5.Fe/c1-11-13-6-8-15(9-7-13)14(11)10-12-4-2-3-5-12;1-2-4-5-3-1;/h2-5,10,13H,1,6-9H2;1-5H;/q;;+2/b14-10+;;.
What are the key properties of CID 10495848?
CID 10495848 has a molecular weight of 319.23 g/mol, XLogP of 3.58, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10495848 is sourced from PubChem (CID 10495848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).