C12H24N2O2 — CID 104959111
4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxan-4-amine (PubChem CID 104959111) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxan-4-amine.
| Compound Name | 4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxan-4-amine |
|---|---|
| PubChem CID | 104959111 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 4-[[(2R,6S)-2,6-dimethylmorpholin-4-yl]methyl]oxan-4-amine |
| SMILES | C[C@@H]1CN(CC2(N)CCOCC2)C[C@H](C)O1 |
| InChI | InChI=1S/C12H24N2O2/c1-10-7-14(8-11(2)16-10)9-12(13)3-5-15-6-4-12/h10-11H,3-9,13H2,1-2H3/t10-,11+ |
| InChIKey | AEPSQWFXQWEIKI-PHIMTYICSA-N |
| XLogP | 0.60 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |