C11H14ClN3O2 — CID 104959220
4-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-5-carbaldehyde (PubChem CID 104959220) has the molecular formula C11H14ClN3O2 and a molecular weight of 255.70 g/mol. Its IUPAC name is 4-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-5-carbaldehyde.
| Compound Name | 4-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-5-carbaldehyde |
|---|---|
| PubChem CID | 104959220 |
| Molecular Formula | C11H14ClN3O2 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 4-chloro-6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]pyrimidine-5-carbaldehyde |
| SMILES | C[C@@H]1CN(c2ncnc(Cl)c2C=O)C[C@H](C)O1 |
| InChI | InChI=1S/C11H14ClN3O2/c1-7-3-15(4-8(2)17-7)11-9(5-16)10(12)13-6-14-11/h5-8H,3-4H2,1-2H3/t7-,8+ |
| InChIKey | VTRNWOWRXFRXDQ-OCAPTIKFSA-N |
| XLogP | 1.56 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|