About [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine
[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine (PubChem CID 104959418) has the molecular formula C11H18N4O
and a molecular weight of 222.29 g/mol. Its IUPAC name is [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine.
Molecular Properties
| Compound Name | [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine |
| PubChem CID | 104959418 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine |
| SMILES | C[C@@H]1CN(c2ncc(CN)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C11H18N4O/c1-8-6-15(7-9(2)16-8)11-13-4-10(3-12)5-14-11/h4-5,8-9H,3,6-7,12H2,1-2H3/t8-,9+ |
| InChIKey | OHQBQGPWVCFNOP-DTORHVGOSA-N |
| XLogP | 0.55 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine?
The IUPAC name of [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine (CID 104959418) is [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine.
What is the SMILES notation for [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine?
The canonical SMILES for [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine is C[C@@H]1CN(c2ncc(CN)cn2)C[C@H](C)O1.
What is the InChIKey of [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine?
The InChIKey is OHQBQGPWVCFNOP-DTORHVGOSA-N. The full InChI is InChI=1S/C11H18N4O/c1-8-6-15(7-9(2)16-8)11-13-4-10(3-12)5-14-11/h4-5,8-9H,3,6-7,12H2,1-2H3/t8-,9+.
What are the key properties of [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine?
[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine has a molecular weight of 222.29 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]pyrimidin-5-yl]methanamine is sourced from PubChem (CID 104959418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).