C15H18FNO3 — CID 104959525
(E)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluorophenyl]prop-2-enoic acid (PubChem CID 104959525) has the molecular formula C15H18FNO3 and a molecular weight of 279.31 g/mol. Its IUPAC name is (E)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 104959525 |
| Molecular Formula | C15H18FNO3 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (E)-3-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-5-fluorophenyl]prop-2-enoic acid |
| SMILES | C[C@@H]1CN(c2ccc(F)cc2/C=C/C(=O)O)C[C@H](C)O1 |
| InChI | InChI=1S/C15H18FNO3/c1-10-8-17(9-11(2)20-10)14-5-4-13(16)7-12(14)3-6-15(18)19/h3-7,10-11H,8-9H2,1-2H3,(H,18,19)/b6-3+/t10-,11+ |
| InChIKey | HIWSTBPTJXHHEA-UBDRWLHQSA-N |
| XLogP | 2.54 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|