About 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol (PubChem CID 104959533) has the molecular formula C8H17NO4S
and a molecular weight of 223.29 g/mol. Its IUPAC name is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol.
Molecular Properties
| Compound Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol |
| PubChem CID | 104959533 |
| Molecular Formula | C8H17NO4S |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol |
| SMILES | C[C@@H]1CN(S(=O)(=O)CCO)C[C@H](C)O1 |
| InChI | InChI=1S/C8H17NO4S/c1-7-5-9(6-8(2)13-7)14(11,12)4-3-10/h7-8,10H,3-6H2,1-2H3/t7-,8+ |
| InChIKey | LWOZWVAAAZRALO-OCAPTIKFSA-N |
| XLogP | -0.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol?
The IUPAC name of 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol (CID 104959533) is 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol.
What is the SMILES notation for 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol?
The canonical SMILES for 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol is C[C@@H]1CN(S(=O)(=O)CCO)C[C@H](C)O1.
What is the InChIKey of 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol?
The InChIKey is LWOZWVAAAZRALO-OCAPTIKFSA-N. The full InChI is InChI=1S/C8H17NO4S/c1-7-5-9(6-8(2)13-7)14(11,12)4-3-10/h7-8,10H,3-6H2,1-2H3/t7-,8+.
What are the key properties of 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol?
2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol has a molecular weight of 223.29 g/mol, XLogP of -0.58, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]sulfonylethanol is sourced from PubChem (CID 104959533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).