C11H16INO2 — CID 10495977
(2E,4E,6Z)-N-[(2S)-1-hydroxypropan-2-yl]-7-iodo-2-methylhepta-2,4,6-trienamide (PubChem CID 10495977) has the molecular formula C11H16INO2 and a molecular weight of 321.16 g/mol. Its IUPAC name is (2E,4E,6Z)-N-[(2S)-1-hydroxypropan-2-yl]-7-iodo-2-methylhepta-2,4,6-trienamide.
| Compound Name | (2E,4E,6Z)-N-[(2S)-1-hydroxypropan-2-yl]-7-iodo-2-methylhepta-2,4,6-trienamide |
|---|---|
| PubChem CID | 10495977 |
| Molecular Formula | C11H16INO2 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | (2E,4E,6Z)-N-[(2S)-1-hydroxypropan-2-yl]-7-iodo-2-methylhepta-2,4,6-trienamide |
| SMILES | C/C(=C\C=C\C=C/I)C(=O)N[C@@H](C)CO |
| InChI | InChI=1S/C11H16INO2/c1-9(6-4-3-5-7-12)11(15)13-10(2)8-14/h3-7,10,14H,8H2,1-2H3,(H,13,15)/b4-3+,7-5-,9-6+/t10-/m0/s1 |
| InChIKey | YRUZVYLFXVVWSA-PDXPZWSFSA-N |
| XLogP | 1.93 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|