C17H22N2O2 — CID 104959905
[2-(3-aminoprop-1-ynyl)-5-methylphenyl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone (PubChem CID 104959905) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is [2-(3-aminoprop-1-ynyl)-5-methylphenyl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone.
| Compound Name | [2-(3-aminoprop-1-ynyl)-5-methylphenyl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
|---|---|
| PubChem CID | 104959905 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | [2-(3-aminoprop-1-ynyl)-5-methylphenyl]-[(2S,6R)-2,6-dimethylmorpholin-4-yl]methanone |
| SMILES | Cc1ccc(C#CCN)c(C(=O)N2C[C@@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C17H22N2O2/c1-12-6-7-15(5-4-8-18)16(9-12)17(20)19-10-13(2)21-14(3)11-19/h6-7,9,13-14H,8,10-11,18H2,1-3H3/t13-,14+ |
| InChIKey | CWPKZKRAQOHXFF-OKILXGFUSA-N |
| XLogP | 1.55 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|