C18H27NO2 — CID 104960111
2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylcyclohexan-1-ol (PubChem CID 104960111) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylcyclohexan-1-ol.
| Compound Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylcyclohexan-1-ol |
|---|---|
| PubChem CID | 104960111 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-4-phenylcyclohexan-1-ol |
| SMILES | C[C@@H]1CN(C2CC(c3ccccc3)CCC2O)C[C@H](C)O1 |
| InChI | InChI=1S/C18H27NO2/c1-13-11-19(12-14(2)21-13)17-10-16(8-9-18(17)20)15-6-4-3-5-7-15/h3-7,13-14,16-18,20H,8-12H2,1-2H3/t13-,14+,16?,17?,18? |
| InChIKey | PIJOKADJUJOTHW-DJOPCMNMSA-N |
| XLogP | 2.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |