C19H30O4 — CID 10496090
methyl (1S,9R,10S,13R)-14-oxo-10-propyl-15-oxatricyclo[7.4.1.110,13]pentadecane-1-carboxylate (PubChem CID 10496090) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is methyl (1S,9R,10S,13R)-14-oxo-10-propyl-15-oxatricyclo[7.4.1.110,13]pentadecane-1-carboxylate.
| Compound Name | methyl (1S,9R,10S,13R)-14-oxo-10-propyl-15-oxatricyclo[7.4.1.110,13]pentadecane-1-carboxylate |
|---|---|
| PubChem CID | 10496090 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | methyl (1S,9R,10S,13R)-14-oxo-10-propyl-15-oxatricyclo[7.4.1.110,13]pentadecane-1-carboxylate |
| SMILES | CCC[C@@]12CC[C@@H](O1)[C@@]1(C(=O)OC)CCCCCCC[C@H]2C1=O |
| InChI | InChI=1S/C19H30O4/c1-3-11-18-13-10-15(23-18)19(17(21)22-2)12-8-6-4-5-7-9-14(18)16(19)20/h14-15H,3-13H2,1-2H3/t14-,15+,18-,19-/m0/s1 |
| InChIKey | VESWNWVFBRAKJD-QXGSTGNESA-N |
| XLogP | 3.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|