C19H34N2O2 — CID 10496106
1-(azepan-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol (PubChem CID 10496106) has the molecular formula C19H34N2O2 and a molecular weight of 322.49 g/mol. Its IUPAC name is 1-(azepan-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol.
| Compound Name | 1-(azepan-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 10496106 |
| Molecular Formula | C19H34N2O2 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.26 |
| IUPAC Name | 1-(azepan-1-yl)-3-[(E)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]oxypropan-2-ol |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)/C(=N/OCC(O)CN1CCCCCC1)C2 |
| InChI | InChI=1S/C19H34N2O2/c1-18(2)15-8-9-19(18,3)17(12-15)20-23-14-16(22)13-21-10-6-4-5-7-11-21/h15-16,22H,4-14H2,1-3H3/b20-17+/t15-,16?,19+/m0/s1 |
| InChIKey | MIZSKFRBTGZEQT-XFPFGHFJSA-N |
| XLogP | 3.44 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|