C15H24N2O — CID 104961099
N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]aniline (PubChem CID 104961099) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]aniline.
| Compound Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]aniline |
|---|---|
| PubChem CID | 104961099 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | N-[2-[(2R,6S)-2,6-dimethylmorpholin-4-yl]propyl]aniline |
| SMILES | CC(CNc1ccccc1)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C15H24N2O/c1-12(9-16-15-7-5-4-6-8-15)17-10-13(2)18-14(3)11-17/h4-8,12-14,16H,9-11H2,1-3H3/t12?,13-,14+ |
| InChIKey | PZPNMGBGLGSXKT-AGUYFDCRSA-N |
| XLogP | 2.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |