C14H24N2OS — CID 104961122
N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-2-thiophen-3-ylethanamine (PubChem CID 104961122) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 104961122 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]-2-thiophen-3-ylethanamine |
| SMILES | C[C@@H]1CN(CCNCCc2ccsc2)C[C@H](C)O1 |
| InChI | InChI=1S/C14H24N2OS/c1-12-9-16(10-13(2)17-12)7-6-15-5-3-14-4-8-18-11-14/h4,8,11-13,15H,3,5-7,9-10H2,1-2H3/t12-,13+ |
| InChIKey | SKSDEYYMFFAFOQ-BETUJISGSA-N |
| XLogP | 1.99 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|