About 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol
2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol (PubChem CID 104961371) has the molecular formula C12H26N2O2
and a molecular weight of 230.35 g/mol. Its IUPAC name is 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol.
Molecular Properties
| Compound Name | 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol |
| PubChem CID | 104961371 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol |
| SMILES | CC(CC(C)(N)CO)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C12H26N2O2/c1-9(5-12(4,13)8-15)14-6-10(2)16-11(3)7-14/h9-11,15H,5-8,13H2,1-4H3/t9?,10-,11+,12? |
| InChIKey | AWWRZLFQNOGQJJ-WSVSKBAQSA-N |
| XLogP | 0.58 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol?
The IUPAC name of 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol (CID 104961371) is 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol.
What is the SMILES notation for 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol?
The canonical SMILES for 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol is CC(CC(C)(N)CO)N1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol?
The InChIKey is AWWRZLFQNOGQJJ-WSVSKBAQSA-N. The full InChI is InChI=1S/C12H26N2O2/c1-9(5-12(4,13)8-15)14-6-10(2)16-11(3)7-14/h9-11,15H,5-8,13H2,1-4H3/t9?,10-,11+,12?.
What are the key properties of 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol?
2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol has a molecular weight of 230.35 g/mol, XLogP of 0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-methylpentan-1-ol is sourced from PubChem (CID 104961371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).